C26H34N4O3S — CID 2958249
4-butoxy-N-[[2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 2958249) has the molecular formula C26H34N4O3S and a molecular weight of 482.65 g/mol. Its IUPAC name is 4-butoxy-N-[[2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 4-butoxy-N-[[2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2958249 |
| Molecular Formula | C26H34N4O3S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 4-butoxy-N-[[2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2ccccc2N2CCN(C(=O)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C26H34N4O3S/c1-4-5-18-33-21-12-10-20(11-13-21)24(31)28-26(34)27-22-8-6-7-9-23(22)29-14-16-30(17-15-29)25(32)19(2)3/h6-13,19H,4-5,14-18H2,1-3H3,(H2,27,28,31,34) |
| InChIKey | BOYNDPIZQLJYHG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|