C22H28N4O4S2 — CID 4273650
N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]-4-propoxybenzamide (PubChem CID 4273650) has the molecular formula C22H28N4O4S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]-4-propoxybenzamide.
| Compound Name | N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 4273650 |
| Molecular Formula | C22H28N4O4S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NC(=S)Nc2ccccc2N2CCN(S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O4S2/c1-3-16-30-18-10-8-17(9-11-18)21(27)24-22(31)23-19-6-4-5-7-20(19)25-12-14-26(15-13-25)32(2,28)29/h4-11H,3,12-16H2,1-2H3,(H2,23,24,27,31) |
| InChIKey | KEBLSOGLHZBSCT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|