C16H24N4O3S2 — CID 3655401
N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]butanamide (PubChem CID 3655401) has the molecular formula C16H24N4O3S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]butanamide.
| Compound Name | N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 3655401 |
| Molecular Formula | C16H24N4O3S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]butanamide |
| SMILES | CCCC(=O)NC(=S)Nc1ccccc1N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H24N4O3S2/c1-3-6-15(21)18-16(24)17-13-7-4-5-8-14(13)19-9-11-20(12-10-19)25(2,22)23/h4-5,7-8H,3,6,9-12H2,1-2H3,(H2,17,18,21,24) |
| InChIKey | XAEJKJWSQAXCHI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|