C19H20Cl2N4O3S2 — CID 5114025
3,4-dichloro-N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 5114025) has the molecular formula C19H20Cl2N4O3S2 and a molecular weight of 487.43 g/mol. Its IUPAC name is 3,4-dichloro-N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5114025 |
| Molecular Formula | C19H20Cl2N4O3S2 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 3,4-dichloro-N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CS(=O)(=O)N1CCN(c2ccccc2NC(=S)NC(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H20Cl2N4O3S2/c1-30(27,28)25-10-8-24(9-11-25)17-5-3-2-4-16(17)22-19(29)23-18(26)13-6-7-14(20)15(21)12-13/h2-7,12H,8-11H2,1H3,(H2,22,23,26,29) |
| InChIKey | MOVOWYKKWDTDOX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|