C26H24Cl2N4O3S — CID 17317446
3-chloro-N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 17317446) has the molecular formula C26H24Cl2N4O3S and a molecular weight of 543.48 g/mol. Its IUPAC name is 3-chloro-N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | 3-chloro-N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 17317446 |
| Molecular Formula | C26H24Cl2N4O3S |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | 3-chloro-N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccccc2N2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C26H24Cl2N4O3S/c1-35-23-11-8-18(16-20(23)28)24(33)30-26(36)29-21-4-2-3-5-22(21)31-12-14-32(15-13-31)25(34)17-6-9-19(27)10-7-17/h2-11,16H,12-15H2,1H3,(H2,29,30,33,36) |
| InChIKey | FVOPGAHHNLGPRI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|