C21H24ClN3O2S — CID 3942245
3-chloro-4-methoxy-N-[[2-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3942245) has the molecular formula C21H24ClN3O2S and a molecular weight of 417.96 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-[[2-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-4-methoxy-N-[[2-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3942245 |
| Molecular Formula | C21H24ClN3O2S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 3-chloro-4-methoxy-N-[[2-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccccc2N2CCC(C)CC2)cc1Cl |
| InChI | InChI=1S/C21H24ClN3O2S/c1-14-9-11-25(12-10-14)18-6-4-3-5-17(18)23-21(28)24-20(26)15-7-8-19(27-2)16(22)13-15/h3-8,13-14H,9-12H2,1-2H3,(H2,23,24,26,28) |
| InChIKey | AJDRRKLRFQSFIR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|