C28H27ClN4O3S — CID 17317473
(E)-N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 17317473) has the molecular formula C28H27ClN4O3S and a molecular weight of 535.07 g/mol. Its IUPAC name is (E)-N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17317473 |
| Molecular Formula | C28H27ClN4O3S |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | (E)-N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)Nc2ccccc2N2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H27ClN4O3S/c1-36-23-13-6-20(7-14-23)8-15-26(34)31-28(37)30-24-4-2-3-5-25(24)32-16-18-33(19-17-32)27(35)21-9-11-22(29)12-10-21/h2-15H,16-19H2,1H3,(H2,30,31,34,37)/b15-8+ |
| InChIKey | IOMVUVASJZUCDV-OVCLIPMQSA-N |
| XLogP | 4.84 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|