C26H26ClN3O4 — CID 17335991
N-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2,4-dimethoxybenzamide (PubChem CID 17335991) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is N-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17335991 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2N2CCN(C(=O)c3ccc(Cl)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C26H26ClN3O4/c1-33-20-11-12-21(24(17-20)34-2)25(31)28-22-5-3-4-6-23(22)29-13-15-30(16-14-29)26(32)18-7-9-19(27)10-8-18/h3-12,17H,13-16H2,1-2H3,(H,28,31) |
| InChIKey | QJCSNIANIZTYOE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |