C27H26Cl2N4O4S — CID 21170668
N-[[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2,6-dimethoxybenzamide (PubChem CID 21170668) has the molecular formula C27H26Cl2N4O4S and a molecular weight of 573.50 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 21170668 |
| Molecular Formula | C27H26Cl2N4O4S |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | N-[[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=S)Nc1ccc(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C27H26Cl2N4O4S/c1-36-22-4-3-5-23(37-2)24(22)25(34)31-27(38)30-19-10-11-21(20(29)16-19)32-12-14-33(15-13-32)26(35)17-6-8-18(28)9-7-17/h3-11,16H,12-15H2,1-2H3,(H2,30,31,34,38) |
| InChIKey | GCMHBLBEVQRMMH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|