C29H24Cl2N4O3S — CID 17317476
N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide (PubChem CID 17317476) has the molecular formula C29H24Cl2N4O3S and a molecular weight of 579.51 g/mol. Its IUPAC name is N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17317476 |
| Molecular Formula | C29H24Cl2N4O3S |
| Molecular Weight | 579.51 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | N-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1N1CCN(C(=O)c2ccc(Cl)cc2)CC1)c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C29H24Cl2N4O3S/c30-21-10-8-19(9-11-21)28(37)35-16-14-34(15-17-35)24-7-2-1-6-23(24)32-29(39)33-27(36)26-13-12-25(38-26)20-4-3-5-22(31)18-20/h1-13,18H,14-17H2,(H2,32,33,36,39) |
| InChIKey | QMGDCKGVNAFQBA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|