C23H19ClF3N3O2S — CID 17115725
5-(3-chlorophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17115725) has the molecular formula C23H19ClF3N3O2S and a molecular weight of 493.94 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17115725 |
| Molecular Formula | C23H19ClF3N3O2S |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(C(F)(F)F)ccc1N1CCCC1)c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C23H19ClF3N3O2S/c24-16-5-3-4-14(12-16)19-8-9-20(32-19)21(31)29-22(33)28-17-13-15(23(25,26)27)6-7-18(17)30-10-1-2-11-30/h3-9,12-13H,1-2,10-11H2,(H2,28,29,31,33) |
| InChIKey | OAXJEDJHQAGPMA-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|