C23H19F3N4O4S — CID 17115728
5-(2-nitrophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17115728) has the molecular formula C23H19F3N4O4S and a molecular weight of 504.49 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2-nitrophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17115728 |
| Molecular Formula | C23H19F3N4O4S |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 5-(2-nitrophenyl)-N-[[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(C(F)(F)F)ccc1N1CCCC1)c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C23H19F3N4O4S/c24-23(25,26)14-7-8-18(29-11-3-4-12-29)16(13-14)27-22(35)28-21(31)20-10-9-19(34-20)15-5-1-2-6-17(15)30(32)33/h1-2,5-10,13H,3-4,11-12H2,(H2,27,28,31,35) |
| InChIKey | VLGZPRIOORGLJA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|