C18H10BrF2N3O4S — CID 17113464
N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 17113464) has the molecular formula C18H10BrF2N3O4S and a molecular weight of 482.26 g/mol. Its IUPAC name is N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17113464 |
| Molecular Formula | C18H10BrF2N3O4S |
| Molecular Weight | 482.26 g/mol |
| Exact Mass | 480.95 |
| IUPAC Name | N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1c(F)cc(F)cc1Br)c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H10BrF2N3O4S/c19-11-7-9(20)8-12(21)16(11)22-18(29)23-17(25)15-6-5-14(28-15)10-3-1-2-4-13(10)24(26)27/h1-8H,(H2,22,23,25,29) |
| InChIKey | ZUHPRWDYSYQEID-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.26 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|