C24H13Br2N3O4S — CID 17318481
N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 17318481) has the molecular formula C24H13Br2N3O4S and a molecular weight of 599.26 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17318481 |
| Molecular Formula | C24H13Br2N3O4S |
| Molecular Weight | 599.26 g/mol |
| Exact Mass | 596.90 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1c(Br)cc(Br)cc1-c1nc2ccccc2s1)c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C24H13Br2N3O4S/c25-13-11-15(24-27-17-6-2-4-8-21(17)34-24)22(16(26)12-13)28-23(30)20-10-9-19(33-20)14-5-1-3-7-18(14)29(31)32/h1-12H,(H,28,30) |
| InChIKey | CQBAKFKMJXIJAS-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.26 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|