C18H10Br3N3O4S — CID 15680829
5-(2-nitrophenyl)-N-[(2,4,6-tribromophenyl)carbamothioyl]furan-2-carboxamide (PubChem CID 15680829) has the molecular formula C18H10Br3N3O4S and a molecular weight of 604.07 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-N-[(2,4,6-tribromophenyl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2-nitrophenyl)-N-[(2,4,6-tribromophenyl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 15680829 |
| Molecular Formula | C18H10Br3N3O4S |
| Molecular Weight | 604.07 g/mol |
| Exact Mass | 600.79 |
| IUPAC Name | 5-(2-nitrophenyl)-N-[(2,4,6-tribromophenyl)carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1c(Br)cc(Br)cc1Br)c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H10Br3N3O4S/c19-9-7-11(20)16(12(21)8-9)22-18(29)23-17(25)15-6-5-14(28-15)10-3-1-2-4-13(10)24(26)27/h1-8H,(H2,22,23,25,29) |
| InChIKey | HPQCFFLZGILHTA-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.07 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|