C15H13N7O4S — CID 4211299
N-[(2-ethyltetrazol-5-yl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 4211299) has the molecular formula C15H13N7O4S and a molecular weight of 387.38 g/mol. Its IUPAC name is N-[(2-ethyltetrazol-5-yl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[(2-ethyltetrazol-5-yl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4211299 |
| Molecular Formula | C15H13N7O4S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-[(2-ethyltetrazol-5-yl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | CCn1nnc(NC(=S)NC(=O)c2ccc(-c3ccccc3[N+](=O)[O-])o2)n1 |
| InChI | InChI=1S/C15H13N7O4S/c1-2-21-19-14(18-20-21)17-15(27)16-13(23)12-8-7-11(26-12)9-5-3-4-6-10(9)22(24)25/h3-8H,2H2,1H3,(H2,16,17,19,23,27) |
| InChIKey | UEXACZLXBPYGJW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|