C17H16Cl2N6O2S — CID 4030687
N-[(2-butyltetrazol-5-yl)carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 4030687) has the molecular formula C17H16Cl2N6O2S and a molecular weight of 439.33 g/mol. Its IUPAC name is N-[(2-butyltetrazol-5-yl)carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[(2-butyltetrazol-5-yl)carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4030687 |
| Molecular Formula | C17H16Cl2N6O2S |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | N-[(2-butyltetrazol-5-yl)carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | CCCCn1nnc(NC(=S)NC(=O)c2ccc(-c3ccc(Cl)cc3Cl)o2)n1 |
| InChI | InChI=1S/C17H16Cl2N6O2S/c1-2-3-8-25-23-16(22-24-25)21-17(28)20-15(26)14-7-6-13(27-14)11-5-4-10(18)9-12(11)19/h4-7,9H,2-3,8H2,1H3,(H2,20,21,23,26,28) |
| InChIKey | OSYXFYYRVDHIQU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|