C14H11ClN6O2S — CID 17334481
5-(4-chlorophenyl)-N-[(2-methyltetrazol-5-yl)carbamothioyl]furan-2-carboxamide (PubChem CID 17334481) has the molecular formula C14H11ClN6O2S and a molecular weight of 362.80 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[(2-methyltetrazol-5-yl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[(2-methyltetrazol-5-yl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17334481 |
| Molecular Formula | C14H11ClN6O2S |
| Molecular Weight | 362.80 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[(2-methyltetrazol-5-yl)carbamothioyl]furan-2-carboxamide |
| SMILES | Cn1nnc(NC(=S)NC(=O)c2ccc(-c3ccc(Cl)cc3)o2)n1 |
| InChI | InChI=1S/C14H11ClN6O2S/c1-21-19-13(18-20-21)17-14(24)16-12(22)11-7-6-10(23-11)8-2-4-9(15)5-3-8/h2-7H,1H3,(H2,16,17,19,22,24) |
| InChIKey | MISRFRWAYHUPSN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.80 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|