C26H20ClN3O3S — CID 17115611
5-(4-chlorophenyl)-N-[[4-[(2-phenylacetyl)amino]phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17115611) has the molecular formula C26H20ClN3O3S and a molecular weight of 489.98 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[[4-[(2-phenylacetyl)amino]phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[[4-[(2-phenylacetyl)amino]phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17115611 |
| Molecular Formula | C26H20ClN3O3S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[[4-[(2-phenylacetyl)amino]phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(NC(=S)NC(=O)c2ccc(-c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C26H20ClN3O3S/c27-19-8-6-18(7-9-19)22-14-15-23(33-22)25(32)30-26(34)29-21-12-10-20(11-13-21)28-24(31)16-17-4-2-1-3-5-17/h1-15H,16H2,(H,28,31)(H2,29,30,32,34) |
| InChIKey | OZPNHBJZZPSRDV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|