C19H14N2O4S — CID 91688386
5-[4-(benzoylcarbamothioylamino)phenyl]furan-2-carboxylic acid (PubChem CID 91688386) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is 5-[4-(benzoylcarbamothioylamino)phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-(benzoylcarbamothioylamino)phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 91688386 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 5-[4-(benzoylcarbamothioylamino)phenyl]furan-2-carboxylic acid |
| SMILES | O=C(NC(=S)Nc1ccc(-c2ccc(C(=O)O)o2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H14N2O4S/c22-17(13-4-2-1-3-5-13)21-19(26)20-14-8-6-12(7-9-14)15-10-11-16(25-15)18(23)24/h1-11H,(H,23,24)(H2,20,21,22,26) |
| InChIKey | QMWJAZTWCWMQHL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|