C22H21ClN2O2S — CID 3850083
N-[(2-butan-2-ylphenyl)carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide (PubChem CID 3850083) has the molecular formula C22H21ClN2O2S and a molecular weight of 412.94 g/mol. Its IUPAC name is N-[(2-butan-2-ylphenyl)carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[(2-butan-2-ylphenyl)carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3850083 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[(2-butan-2-ylphenyl)carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide |
| SMILES | CCC(C)c1ccccc1NC(=S)NC(=O)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C22H21ClN2O2S/c1-3-14(2)17-6-4-5-7-18(17)24-22(28)25-21(26)20-13-12-19(27-20)15-8-10-16(23)11-9-15/h4-14H,3H2,1-2H3,(H2,24,25,26,28) |
| InChIKey | APZFQPPERFTWML-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|