C15H22N2OS — CID 823948
N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-2-methylpropanamide (PubChem CID 823948) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-2-methylpropanamide.
| Compound Name | N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 823948 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-2-methylpropanamide |
| SMILES | CC[C@H](C)c1ccccc1NC(=S)NC(=O)C(C)C |
| InChI | InChI=1S/C15H22N2OS/c1-5-11(4)12-8-6-7-9-13(12)16-15(19)17-14(18)10(2)3/h6-11H,5H2,1-4H3,(H2,16,17,18,19)/t11-/m0/s1 |
| InChIKey | ILHCCTJQUVVPBC-NSHDSACASA-N |
| XLogP | 3.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|