C18H19ClN2OS — CID 959760
N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-4-chlorobenzamide (PubChem CID 959760) has the molecular formula C18H19ClN2OS and a molecular weight of 346.88 g/mol. Its IUPAC name is N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-4-chlorobenzamide.
| Compound Name | N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 959760 |
| Molecular Formula | C18H19ClN2OS |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-4-chlorobenzamide |
| SMILES | CC[C@H](C)c1ccccc1NC(=S)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2OS/c1-3-12(2)15-6-4-5-7-16(15)20-18(23)21-17(22)13-8-10-14(19)11-9-13/h4-12H,3H2,1-2H3,(H2,20,21,22,23)/t12-/m0/s1 |
| InChIKey | UVOFBTMRAJJQAF-LBPRGKRZSA-N |
| XLogP | 4.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|