C18H18I2N2OS — CID 124554564
N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-2,5-diiodobenzamide (PubChem CID 124554564) has the molecular formula C18H18I2N2OS and a molecular weight of 564.23 g/mol. Its IUPAC name is N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-2,5-diiodobenzamide.
| Compound Name | N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-2,5-diiodobenzamide |
|---|---|
| PubChem CID | 124554564 |
| Molecular Formula | C18H18I2N2OS |
| Molecular Weight | 564.23 g/mol |
| Exact Mass | 563.92 |
| IUPAC Name | N-[[2-[(2S)-butan-2-yl]phenyl]carbamothioyl]-2,5-diiodobenzamide |
| SMILES | CC[C@H](C)c1ccccc1NC(=S)NC(=O)c1cc(I)ccc1I |
| InChI | InChI=1S/C18H18I2N2OS/c1-3-11(2)13-6-4-5-7-16(13)21-18(24)22-17(23)14-10-12(19)8-9-15(14)20/h4-11H,3H2,1-2H3,(H2,21,22,23,24)/t11-/m0/s1 |
| InChIKey | YWLVGPFDRVULRK-NSHDSACASA-N |
| XLogP | 5.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.23 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|