C18H17BrI2N2OS — CID 124587303
2-bromo-N-[[2-[(2R)-butan-2-yl]phenyl]carbamothioyl]-3,5-diiodobenzamide (PubChem CID 124587303) has the molecular formula C18H17BrI2N2OS and a molecular weight of 643.13 g/mol. Its IUPAC name is 2-bromo-N-[[2-[(2R)-butan-2-yl]phenyl]carbamothioyl]-3,5-diiodobenzamide.
| Compound Name | 2-bromo-N-[[2-[(2R)-butan-2-yl]phenyl]carbamothioyl]-3,5-diiodobenzamide |
|---|---|
| PubChem CID | 124587303 |
| Molecular Formula | C18H17BrI2N2OS |
| Molecular Weight | 643.13 g/mol |
| Exact Mass | 641.83 |
| IUPAC Name | 2-bromo-N-[[2-[(2R)-butan-2-yl]phenyl]carbamothioyl]-3,5-diiodobenzamide |
| SMILES | CC[C@@H](C)c1ccccc1NC(=S)NC(=O)c1cc(I)cc(I)c1Br |
| InChI | InChI=1S/C18H17BrI2N2OS/c1-3-10(2)12-6-4-5-7-15(12)22-18(25)23-17(24)13-8-11(20)9-14(21)16(13)19/h4-10H,3H2,1-2H3,(H2,22,23,24,25)/t10-/m1/s1 |
| InChIKey | SXASGWCOAGCKGQ-SNVBAGLBSA-N |
| XLogP | 6.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.13 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|