C15H8BrI3N2O3S — CID 5180175
2-[(2-bromo-3,5-diiodobenzoyl)carbamothioylamino]-5-iodobenzoic acid (PubChem CID 5180175) has the molecular formula C15H8BrI3N2O3S and a molecular weight of 756.92 g/mol. Its IUPAC name is 2-[(2-bromo-3,5-diiodobenzoyl)carbamothioylamino]-5-iodobenzoic acid.
| Compound Name | 2-[(2-bromo-3,5-diiodobenzoyl)carbamothioylamino]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 5180175 |
| Molecular Formula | C15H8BrI3N2O3S |
| Molecular Weight | 756.92 g/mol |
| Exact Mass | 755.66 |
| IUPAC Name | 2-[(2-bromo-3,5-diiodobenzoyl)carbamothioylamino]-5-iodobenzoic acid |
| SMILES | O=C(O)c1cc(I)ccc1NC(=S)NC(=O)c1cc(I)cc(I)c1Br |
| InChI | InChI=1S/C15H8BrI3N2O3S/c16-12-9(4-7(18)5-10(12)19)13(22)21-15(25)20-11-2-1-6(17)3-8(11)14(23)24/h1-5H,(H,23,24)(H2,20,21,22,25) |
| InChIKey | DRPSPEVSDBTDEJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.92 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|