C21H15IN2O3S — CID 5172277
5-iodo-2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid (PubChem CID 5172277) has the molecular formula C21H15IN2O3S and a molecular weight of 502.33 g/mol. Its IUPAC name is 5-iodo-2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 5-iodo-2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 5172277 |
| Molecular Formula | C21H15IN2O3S |
| Molecular Weight | 502.33 g/mol |
| Exact Mass | 501.98 |
| IUPAC Name | 5-iodo-2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(NC(=S)Nc1ccc(I)cc1C(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15IN2O3S/c22-16-10-11-18(17(12-16)20(26)27)23-21(28)24-19(25)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H,(H,26,27)(H2,23,24,25,28) |
| InChIKey | ZRSYOUKQFJYEKJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.33 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|