C21H14Cl2N2O3S — CID 3280413
3,5-dichloro-2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid (PubChem CID 3280413) has the molecular formula C21H14Cl2N2O3S and a molecular weight of 445.33 g/mol. Its IUPAC name is 3,5-dichloro-2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 3,5-dichloro-2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 3280413 |
| Molecular Formula | C21H14Cl2N2O3S |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 3,5-dichloro-2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(NC(=S)Nc1c(Cl)cc(Cl)cc1C(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O3S/c22-15-10-16(20(27)28)18(17(23)11-15)24-21(29)25-19(26)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H,(H,27,28)(H2,24,25,26,29) |
| InChIKey | BFOZQTYSXDYLSR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|