C19H18Cl2N2O4S — CID 3280424
2-[(4-butoxybenzoyl)carbamothioylamino]-3,5-dichlorobenzoic acid (PubChem CID 3280424) has the molecular formula C19H18Cl2N2O4S and a molecular weight of 441.34 g/mol. Its IUPAC name is 2-[(4-butoxybenzoyl)carbamothioylamino]-3,5-dichlorobenzoic acid.
| Compound Name | 2-[(4-butoxybenzoyl)carbamothioylamino]-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 3280424 |
| Molecular Formula | C19H18Cl2N2O4S |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 2-[(4-butoxybenzoyl)carbamothioylamino]-3,5-dichlorobenzoic acid |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2c(Cl)cc(Cl)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O4S/c1-2-3-8-27-13-6-4-11(5-7-13)17(24)23-19(28)22-16-14(18(25)26)9-12(20)10-15(16)21/h4-7,9-10H,2-3,8H2,1H3,(H,25,26)(H2,22,23,24,28) |
| InChIKey | IKFMLFKJPHGSHY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|