C11H10Cl2N2O3S — CID 960380
3,5-dichloro-2-(propanoylcarbamothioylamino)benzoic acid (PubChem CID 960380) has the molecular formula C11H10Cl2N2O3S and a molecular weight of 321.19 g/mol. Its IUPAC name is 3,5-dichloro-2-(propanoylcarbamothioylamino)benzoic acid.
| Compound Name | 3,5-dichloro-2-(propanoylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 960380 |
| Molecular Formula | C11H10Cl2N2O3S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 3,5-dichloro-2-(propanoylcarbamothioylamino)benzoic acid |
| SMILES | CCC(=O)NC(=S)Nc1c(Cl)cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C11H10Cl2N2O3S/c1-2-8(16)14-11(19)15-9-6(10(17)18)3-5(12)4-7(9)13/h3-4H,2H2,1H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | PVNFXFQKOMTHHV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|