C11H9Cl2NO3 — CID 55103432
2-(but-3-enoylamino)-3,5-dichlorobenzoic acid (PubChem CID 55103432) has the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. Its IUPAC name is 2-(but-3-enoylamino)-3,5-dichlorobenzoic acid.
| Compound Name | 2-(but-3-enoylamino)-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 55103432 |
| Molecular Formula | C11H9Cl2NO3 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 2-(but-3-enoylamino)-3,5-dichlorobenzoic acid |
| SMILES | C=CCC(=O)Nc1c(Cl)cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C11H9Cl2NO3/c1-2-3-9(15)14-10-7(11(16)17)4-6(12)5-8(10)13/h2,4-5H,1,3H2,(H,14,15)(H,16,17) |
| InChIKey | MLDZUODXXSHMAL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|