C14H14Cl2N2O3 — CID 61193637
2-[bis(prop-2-enyl)carbamoylamino]-3,5-dichlorobenzoic acid (PubChem CID 61193637) has the molecular formula C14H14Cl2N2O3 and a molecular weight of 329.18 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)carbamoylamino]-3,5-dichlorobenzoic acid.
| Compound Name | 2-[bis(prop-2-enyl)carbamoylamino]-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 61193637 |
| Molecular Formula | C14H14Cl2N2O3 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-[bis(prop-2-enyl)carbamoylamino]-3,5-dichlorobenzoic acid |
| SMILES | C=CCN(CC=C)C(=O)Nc1c(Cl)cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C14H14Cl2N2O3/c1-3-5-18(6-4-2)14(21)17-12-10(13(19)20)7-9(15)8-11(12)16/h3-4,7-8H,1-2,5-6H2,(H,17,21)(H,19,20) |
| InChIKey | BBIHPZUFRQDWRV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|