C11H9Cl3N2O5 — CID 63646935
2-[carboxymethyl-[(2,4,6-trichlorophenyl)carbamoyl]amino]acetic acid (PubChem CID 63646935) has the molecular formula C11H9Cl3N2O5 and a molecular weight of 355.56 g/mol. Its IUPAC name is 2-[carboxymethyl-[(2,4,6-trichlorophenyl)carbamoyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(2,4,6-trichlorophenyl)carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 63646935 |
| Molecular Formula | C11H9Cl3N2O5 |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 2-[carboxymethyl-[(2,4,6-trichlorophenyl)carbamoyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl3N2O5/c12-5-1-6(13)10(7(14)2-5)15-11(21)16(3-8(17)18)4-9(19)20/h1-2H,3-4H2,(H,15,21)(H,17,18)(H,19,20) |
| InChIKey | FXFNGJSOUQNAFY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |