C11H11Cl2FN2O3 — CID 107576369
2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-ethylamino]acetic acid (PubChem CID 107576369) has the molecular formula C11H11Cl2FN2O3 and a molecular weight of 309.12 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-ethylamino]acetic acid.
| Compound Name | 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-ethylamino]acetic acid |
|---|---|
| PubChem CID | 107576369 |
| Molecular Formula | C11H11Cl2FN2O3 |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2FN2O3/c1-2-16(5-9(17)18)11(19)15-6-3-7(12)10(14)8(13)4-6/h3-4H,2,5H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | TWSWQLRGCQSEBT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|