About 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid
2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid (PubChem CID 107576404) has the molecular formula C12H13Cl2FN2O4
and a molecular weight of 339.15 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid |
| PubChem CID | 107576404 |
| Molecular Formula | C12H13Cl2FN2O4 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2FN2O4/c1-21-3-2-17(6-10(18)19)12(20)16-7-4-8(13)11(15)9(14)5-7/h4-5H,2-3,6H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | TXJDTBMSTXMPJC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid?
The IUPAC name of 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid (CID 107576404) is 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid.
What is the SMILES notation for 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid?
The canonical SMILES for 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid is COCCN(CC(=O)O)C(=O)Nc1cc(Cl)c(F)c(Cl)c1.
What is the InChIKey of 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid?
The InChIKey is TXJDTBMSTXMPJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2FN2O4/c1-21-3-2-17(6-10(18)19)12(20)16-7-4-8(13)11(15)9(14)5-7/h4-5H,2-3,6H2,1H3,(H,16,20)(H,18,19).
What are the key properties of 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid?
2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid has a molecular weight of 339.15 g/mol, XLogP of 2.70, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dichloro-4-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]acetic acid is sourced from PubChem (CID 107576404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).