C10H14N2O4S — CID 79282464
2-[2-methoxyethyl(thiophen-3-ylcarbamoyl)amino]acetic acid (PubChem CID 79282464) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-[2-methoxyethyl(thiophen-3-ylcarbamoyl)amino]acetic acid.
| Compound Name | 2-[2-methoxyethyl(thiophen-3-ylcarbamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 79282464 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[2-methoxyethyl(thiophen-3-ylcarbamoyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)Nc1ccsc1 |
| InChI | InChI=1S/C10H14N2O4S/c1-16-4-3-12(6-9(13)14)10(15)11-8-2-5-17-7-8/h2,5,7H,3-4,6H2,1H3,(H,11,15)(H,13,14) |
| InChIKey | AOYCQBQCGUYZSS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |