C19H24N2O3 — CID 108867129
1,1-bis(2-methoxyethyl)-3-(4-phenylphenyl)urea (PubChem CID 108867129) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1,1-bis(2-methoxyethyl)-3-(4-phenylphenyl)urea.
| Compound Name | 1,1-bis(2-methoxyethyl)-3-(4-phenylphenyl)urea |
|---|---|
| PubChem CID | 108867129 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1,1-bis(2-methoxyethyl)-3-(4-phenylphenyl)urea |
| SMILES | COCCN(CCOC)C(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-23-14-12-21(13-15-24-2)19(22)20-18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11H,12-15H2,1-2H3,(H,20,22) |
| InChIKey | QCVATEDELIXZIQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |