C15H21N3O3 — CID 56825813
3-(1H-indol-5-yl)-1,1-bis(2-methoxyethyl)urea (PubChem CID 56825813) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-(1H-indol-5-yl)-1,1-bis(2-methoxyethyl)urea.
| Compound Name | 3-(1H-indol-5-yl)-1,1-bis(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 56825813 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-(1H-indol-5-yl)-1,1-bis(2-methoxyethyl)urea |
| SMILES | COCCN(CCOC)C(=O)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C15H21N3O3/c1-20-9-7-18(8-10-21-2)15(19)17-13-3-4-14-12(11-13)5-6-16-14/h3-6,11,16H,7-10H2,1-2H3,(H,17,19) |
| InChIKey | LKPDBTVYPYXRHE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |