C13H18Cl2N2O5S — CID 45156351
4-[bis(2-methoxyethyl)carbamoylamino]-2-chlorobenzenesulfonyl chloride (PubChem CID 45156351) has the molecular formula C13H18Cl2N2O5S and a molecular weight of 385.27 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)carbamoylamino]-2-chlorobenzenesulfonyl chloride.
| Compound Name | 4-[bis(2-methoxyethyl)carbamoylamino]-2-chlorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 45156351 |
| Molecular Formula | C13H18Cl2N2O5S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 4-[bis(2-methoxyethyl)carbamoylamino]-2-chlorobenzenesulfonyl chloride |
| SMILES | COCCN(CCOC)C(=O)Nc1ccc(S(=O)(=O)Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O5S/c1-21-7-5-17(6-8-22-2)13(18)16-10-3-4-12(11(14)9-10)23(15,19)20/h3-4,9H,5-8H2,1-2H3,(H,16,18) |
| InChIKey | QSUFKGWMVDCUSC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |