C15H22Cl2N2O3S — CID 45156372
2-chloro-4-(dibutylcarbamoylamino)benzenesulfonyl chloride (PubChem CID 45156372) has the molecular formula C15H22Cl2N2O3S and a molecular weight of 381.33 g/mol. Its IUPAC name is 2-chloro-4-(dibutylcarbamoylamino)benzenesulfonyl chloride.
| Compound Name | 2-chloro-4-(dibutylcarbamoylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 45156372 |
| Molecular Formula | C15H22Cl2N2O3S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-chloro-4-(dibutylcarbamoylamino)benzenesulfonyl chloride |
| SMILES | CCCCN(CCCC)C(=O)Nc1ccc(S(=O)(=O)Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2O3S/c1-3-5-9-19(10-6-4-2)15(20)18-12-7-8-14(13(16)11-12)23(17,21)22/h7-8,11H,3-6,9-10H2,1-2H3,(H,18,20) |
| InChIKey | BUTNJQAVSZMCLV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |