C15H24N2O3 — CID 108895483
1,1-dibutyl-3-(3,5-dihydroxyphenyl)urea (PubChem CID 108895483) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1,1-dibutyl-3-(3,5-dihydroxyphenyl)urea.
| Compound Name | 1,1-dibutyl-3-(3,5-dihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108895483 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1,1-dibutyl-3-(3,5-dihydroxyphenyl)urea |
| SMILES | CCCCN(CCCC)C(=O)Nc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-3-5-7-17(8-6-4-2)15(20)16-12-9-13(18)11-14(19)10-12/h9-11,18-19H,3-8H2,1-2H3,(H,16,20) |
| InChIKey | KBJIRHOIOQSLCR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |