About 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea
3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea (PubChem CID 111120524) has the molecular formula C14H20F2N2O2
and a molecular weight of 286.32 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea.
Molecular Properties
| Compound Name | 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea |
| PubChem CID | 111120524 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea |
| SMILES | CCCCCN(CCO)C(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-2-3-4-5-18(6-7-19)14(20)17-13-9-11(15)8-12(16)10-13/h8-10,19H,2-7H2,1H3,(H,17,20) |
| InChIKey | CFVAQNSMOPAWHH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea?
The IUPAC name of 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea (CID 111120524) is 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea.
What is the SMILES notation for 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea?
The canonical SMILES for 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea is CCCCCN(CCO)C(=O)Nc1cc(F)cc(F)c1.
What is the InChIKey of 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea?
The InChIKey is CFVAQNSMOPAWHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2O2/c1-2-3-4-5-18(6-7-19)14(20)17-13-9-11(15)8-12(16)10-13/h8-10,19H,2-7H2,1H3,(H,17,20).
What are the key properties of 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea?
3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea has a molecular weight of 286.32 g/mol, XLogP of 2.98, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea is sourced from PubChem (CID 111120524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).