C17H26FN3O2 — CID 110896952
1-butyl-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1-(2-hydroxyethyl)urea (PubChem CID 110896952) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 1-butyl-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1-(2-hydroxyethyl)urea.
| Compound Name | 1-butyl-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110896952 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-butyl-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1-(2-hydroxyethyl)urea |
| SMILES | CCCCN(CCO)C(=O)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C17H26FN3O2/c1-2-3-8-21(11-12-22)17(23)19-14-6-7-16(15(18)13-14)20-9-4-5-10-20/h6-7,13,22H,2-5,8-12H2,1H3,(H,19,23) |
| InChIKey | PVCCQBATSLVPRX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|