C15H22FN3O — CID 47264836
1,1-diethyl-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)urea (PubChem CID 47264836) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is 1,1-diethyl-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)urea.
| Compound Name | 1,1-diethyl-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 47264836 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1,1-diethyl-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)urea |
| SMILES | CCN(CC)C(=O)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C15H22FN3O/c1-3-18(4-2)15(20)17-12-7-8-14(13(16)11-12)19-9-5-6-10-19/h7-8,11H,3-6,9-10H2,1-2H3,(H,17,20) |
| InChIKey | CJZOAEBUNLLUBT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|