C23H28F2N4O2 — CID 1067019
5-[(3,4-difluorophenyl)carbamoylamino]-N,N-diethyl-2-piperidin-1-ylbenzamide (PubChem CID 1067019) has the molecular formula C23H28F2N4O2 and a molecular weight of 430.50 g/mol. Its IUPAC name is 5-[(3,4-difluorophenyl)carbamoylamino]-N,N-diethyl-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(3,4-difluorophenyl)carbamoylamino]-N,N-diethyl-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1067019 |
| Molecular Formula | C23H28F2N4O2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 5-[(3,4-difluorophenyl)carbamoylamino]-N,N-diethyl-2-piperidin-1-ylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)Nc2ccc(F)c(F)c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C23H28F2N4O2/c1-3-28(4-2)22(30)18-14-16(9-11-21(18)29-12-6-5-7-13-29)26-23(31)27-17-8-10-19(24)20(25)15-17/h8-11,14-15H,3-7,12-13H2,1-2H3,(H2,26,27,31) |
| InChIKey | ZBRLORUOKSJGFU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|