C22H27BrN4O2 — CID 1067188
5-[(4-bromophenyl)carbamoylamino]-N,N-diethyl-2-pyrrolidin-1-ylbenzamide (PubChem CID 1067188) has the molecular formula C22H27BrN4O2 and a molecular weight of 459.39 g/mol. Its IUPAC name is 5-[(4-bromophenyl)carbamoylamino]-N,N-diethyl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(4-bromophenyl)carbamoylamino]-N,N-diethyl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1067188 |
| Molecular Formula | C22H27BrN4O2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 5-[(4-bromophenyl)carbamoylamino]-N,N-diethyl-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)Nc2ccc(Br)cc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C22H27BrN4O2/c1-3-26(4-2)21(28)19-15-18(11-12-20(19)27-13-5-6-14-27)25-22(29)24-17-9-7-16(23)8-10-17/h7-12,15H,3-6,13-14H2,1-2H3,(H2,24,25,29) |
| InChIKey | RQQUQLKDDHQQQD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|