C14H21FN2O2S — CID 111475389
1-butyl-3-(3-fluoro-4-methylsulfanylphenyl)-1-(2-hydroxyethyl)urea (PubChem CID 111475389) has the molecular formula C14H21FN2O2S and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-butyl-3-(3-fluoro-4-methylsulfanylphenyl)-1-(2-hydroxyethyl)urea.
| Compound Name | 1-butyl-3-(3-fluoro-4-methylsulfanylphenyl)-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 111475389 |
| Molecular Formula | C14H21FN2O2S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-butyl-3-(3-fluoro-4-methylsulfanylphenyl)-1-(2-hydroxyethyl)urea |
| SMILES | CCCCN(CCO)C(=O)Nc1ccc(SC)c(F)c1 |
| InChI | InChI=1S/C14H21FN2O2S/c1-3-4-7-17(8-9-18)14(19)16-11-5-6-13(20-2)12(15)10-11/h5-6,10,18H,3-4,7-9H2,1-2H3,(H,16,19) |
| InChIKey | QOPPUJPPTIBSSL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |