C14H20F2N2O2 — CID 111120402
3-(2,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea (PubChem CID 111120402) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea.
| Compound Name | 3-(2,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea |
|---|---|
| PubChem CID | 111120402 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-(2,5-difluorophenyl)-1-(2-hydroxyethyl)-1-pentylurea |
| SMILES | CCCCCN(CCO)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C14H20F2N2O2/c1-2-3-4-7-18(8-9-19)14(20)17-13-10-11(15)5-6-12(13)16/h5-6,10,19H,2-4,7-9H2,1H3,(H,17,20) |
| InChIKey | QSOCVMYUADYCMR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|