C16H21FN2O3 — CID 111475231
1-butyl-3-(4-fluoro-2-prop-2-ynoxyphenyl)-1-(2-hydroxyethyl)urea (PubChem CID 111475231) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is 1-butyl-3-(4-fluoro-2-prop-2-ynoxyphenyl)-1-(2-hydroxyethyl)urea.
| Compound Name | 1-butyl-3-(4-fluoro-2-prop-2-ynoxyphenyl)-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 111475231 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-butyl-3-(4-fluoro-2-prop-2-ynoxyphenyl)-1-(2-hydroxyethyl)urea |
| SMILES | C#CCOc1cc(F)ccc1NC(=O)N(CCO)CCCC |
| InChI | InChI=1S/C16H21FN2O3/c1-3-5-8-19(9-10-20)16(21)18-14-7-6-13(17)12-15(14)22-11-4-2/h2,6-7,12,20H,3,5,8-11H2,1H3,(H,18,21) |
| InChIKey | QIBBLISIFFUGCF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|