C13H19F2N3O — CID 43288499
1-(3-aminopropyl)-3-(2,4-difluorophenyl)-1-propylurea (PubChem CID 43288499) has the molecular formula C13H19F2N3O and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-(2,4-difluorophenyl)-1-propylurea.
| Compound Name | 1-(3-aminopropyl)-3-(2,4-difluorophenyl)-1-propylurea |
|---|---|
| PubChem CID | 43288499 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1-(3-aminopropyl)-3-(2,4-difluorophenyl)-1-propylurea |
| SMILES | CCCN(CCCN)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H19F2N3O/c1-2-7-18(8-3-6-16)13(19)17-12-5-4-10(14)9-11(12)15/h4-5,9H,2-3,6-8,16H2,1H3,(H,17,19) |
| InChIKey | FMFANKZAPVNJKG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |